Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

Answer

2,4-Dichloro-1-(trichloromethyl)benzene
2,4-Dichloro-1-(trichloromethyl)benzene is a crystalline solid with a molecular weight of approximately 327.66 g/mol. It has low solubility in water but is more soluble in organic solvents like methylene chloride. Chemically, it is highly reactive and susceptible to hydrolysis under basic conditions. It is also prone to photodegradation and has low reactivity towards nucleophiles.

About

CAS No 13014-18-1
English Name 2,4-Dichloro-1-(trichloromethyl)benzene
Molecular Formula C7H3Cl5
Molecular Weight 264.37 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(Cl)(Cl)Cl
InChIKey KZSNBJMYJWDVTK-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1) typically synthesized?

2,4-Dichloro-1-(trichloromethyl)benzene is usually synthesized via the reaction of 2,4-dichlorobenzo...

Compound Q&A

What industries use 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

2,4-Dichloro-1-(trichloromethyl)benzene is primarily used in the synthesis of dyes and pigments. It ...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1-(trichloromethyl)benzene (CAS: 13014-18-1)?

Laboratory handling of 2,4-Dichloro-1-(trichloromethyl)benzene requires the use of appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...