Compound Q&A

What industries use Methyl 3-(trimethylsilyl)-4-pentenoate (CAS: 185411-12-5)?

Answer

Methyl 3-(trimethylsilyl)-4-pentenoate
Methyl 3-(trimethylsilyl)-4-pentenoate is used in the pharmaceutical industry for the synthesis of various organic compounds. It is also employed in the polymer industry for the modification of polymers and in the semiconductor industry as a precursor for organosilicon compounds. Additionally, it has applications in the development of chemical sensors and as a reagent in analytical chemistry.

About

English Name Methyl 3-(trimethylsilyl)-4-pentenoate
Molecular Formula C9H18O2Si
Molecular Weight 186.33 g/mol
SMILES COC(=O)CC(C=C)[Si](C)(C)C
InChIKey DJXDHDYQDMVTPZ-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(trimethylsilyl)-4-pentenoate (CAS: 185411-12-5)?

Methyl 3-(trimethylsilyl)-4-pentenoate is a colorless liquid with a molecular weight of approximatel...

Compound Q&A

How is Methyl 3-(trimethylsilyl)-4-pentenoate (CAS: 185411-12-5) typically synthesized?

Methyl 3-(trimethylsilyl)-4-pentenoate is typically synthesized via the Wittig reaction, where 4-pen...

Compound Q&A

What precautions should be taken when handling Methyl 3-(trimethylsilyl)-4-pentenoate (CAS: 185411-12-5)?

When handling Methyl 3-(trimethylsilyl)-4-pentenoate, it is important to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...