Compound Q&A

What industries use 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

Answer

4-(Dihydroxyboryl)-2-fluorobenzoic acid
4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) is primarily used in pharmaceuticals and research chemistry due to its structural complexity and reactivity. It can also be used in polymer synthesis and as a sensor component, although its specific applications in these areas are limited.

About

English Name 4-(Dihydroxyboryl)-2-fluorobenzoic acid
Molecular Formula C7H6BFO4
Molecular Weight 183.93099999999998 g/mol
SMILES B(C1=CC(=C(C=C1)C(=O)O)F)(O)O
InChIKey CZDWJVSOQOMYGC-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) is a white crystalline solid with a molec...

Compound Q&A

How is 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) typically synthesized?

4-(Dihydroxyboryl)-2-fluorobenzoic acid can be synthesized by the reaction of 2-fluorobenzoic acid w...

Compound Q&A

What precautions should be taken when handling 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

When handling 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4), wear appropriate personal ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...