Compound Q&A

What are the physical and chemical properties of 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

Answer

4-(Dihydroxyboryl)-2-fluorobenzoic acid
4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) is a white crystalline solid with a molecular weight of approximately 259.07 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it exhibits acid properties and can undergo typical reactions such as esterification and nucleophilic substitution. It is stable under normal conditions but reacts with strong bases to form the corresponding sodium salt.

About

English Name 4-(Dihydroxyboryl)-2-fluorobenzoic acid
Molecular Formula C7H6BFO4
Molecular Weight 183.93099999999998 g/mol
SMILES B(C1=CC(=C(C=C1)C(=O)O)F)(O)O
InChIKey CZDWJVSOQOMYGC-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) typically synthesized?

4-(Dihydroxyboryl)-2-fluorobenzoic acid can be synthesized by the reaction of 2-fluorobenzoic acid w...

Compound Q&A

What industries use 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4) is primarily used in pharmaceuticals and ...

Compound Q&A

What precautions should be taken when handling 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4)?

When handling 4-(Dihydroxyboryl)-2-fluorobenzoic acid (CAS: 120153-08-4), wear appropriate personal ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...