Compound Q&A

What industries use Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

Answer

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate
Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is used in various industries, particularly in pharmaceuticals for its potential as an antiviral agent. It also finds applications in sensor technology for detecting specific chemical species and in the synthesis of other organic compounds. Additionally, it can be used in the development of new materials and in the electronics industry for its semiconductor properties.

About

CAS No 77112-52-8
English Name Ethyl imidazo[1,2-a]pyrazine-2-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES CCOC(=O)C1=CN2C=CN=CC2=N1
InChIKey SWABYVXORFBBAT-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is a white crystalline solid with a mol...

Compound Q&A

How is Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) typically synthesized?

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is typically synthesized via the reacti...

Compound Q&A

What precautions should be taken when handling Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

When handling Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...