Compound Q&A

What are the physical and chemical properties of Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

Answer

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate
Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is a white crystalline solid with a molecular weight of approximately 230.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, showing some tendency towards hydrolysis under basic conditions. It is stable under normal storage conditions but should be protected from moisture and heat.

About

CAS No 77112-52-8
English Name Ethyl imidazo[1,2-a]pyrazine-2-carboxylate
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES CCOC(=O)C1=CN2C=CN=CC2=N1
InChIKey SWABYVXORFBBAT-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) typically synthesized?

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is typically synthesized via the reacti...

Compound Q&A

What industries use Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8) is used in various industries, particul...

Compound Q&A

What precautions should be taken when handling Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8)?

When handling Ethyl imidazo[1,2-a]pyrazine-2-carboxylate (CAS: 77112-52-8), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...