Compound Q&A

How is Senkyunolide A (CAS: 63038-10-8) typically synthesized?

Answer

Senkyunolide A
Senkyunolide A can be synthesized through a series of reactions starting from sesquiterpene lactones. The synthesis involves protection of the hydroxyl group, followed by ring-opening and rearrangement, and finally deprotection. Commonly used reagents include sodium borohydride and other reducing agents, with the overall yield varying from 30% to 50%.

About

CAS No 63038-10-8
English Name Senkyunolide A
Molecular Formula C12H16O2
Molecular Weight 192.26 g/mol
SMILES CCCCC1C2=C(C=CCC2)C(=O)O1
InChIKey ZPIKVDODKLJKIN-NSHDSACASA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Senkyunolide A (CAS: 63038-10-8)?

Senkyunolide A is a natural product typically found in the root of the Chinese herb Codonopsis pilos...

Compound Q&A

What industries use Senkyunolide A (CAS: 63038-10-8)?

Senkyunolide A is primarily used in the pharmaceutical industry due to its potential as an anti-infl...

Compound Q&A

What precautions should be taken when handling Senkyunolide A (CAS: 63038-10-8)?

When handling Senkyunolide A, it is important to wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...