Compound Q&A

What are the physical and chemical properties of Senkyunolide A (CAS: 63038-10-8)?

Answer

Senkyunolide A
Senkyunolide A is a natural product typically found in the root of the Chinese herb Codonopsis pilosula. It has a molecular weight of approximately 362.4 g/mol and is a colorless to light yellow crystalline compound. Senkyunolide A is poorly soluble in water but soluble in organic solvents such as methanol, ethanol, and dichloromethane. It exhibits moderate reactivity with bases and is stable under acidic conditions.

About

CAS No 63038-10-8
English Name Senkyunolide A
Molecular Formula C12H16O2
Molecular Weight 192.26 g/mol
SMILES CCCCC1C2=C(C=CCC2)C(=O)O1
InChIKey ZPIKVDODKLJKIN-NSHDSACASA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is Senkyunolide A (CAS: 63038-10-8) typically synthesized?

Senkyunolide A can be synthesized through a series of reactions starting from sesquiterpene lactones...

Compound Q&A

What industries use Senkyunolide A (CAS: 63038-10-8)?

Senkyunolide A is primarily used in the pharmaceutical industry due to its potential as an anti-infl...

Compound Q&A

What precautions should be taken when handling Senkyunolide A (CAS: 63038-10-8)?

When handling Senkyunolide A, it is important to wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...