Compound Q&A

What precautions should be taken when handling Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9)?

Answer

Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine
When handling Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Handle the compound in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up with appropriate absorbent material, and proper disposal methods should be followed. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 72003-83-9
English Name Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine
Molecular Formula C10H13N5Na2O9P2
Molecular Weight 455.17 g/mol
SMILES C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)([O-])OP(=O)(O)[O-])O.[Na+].[Na+]
InChIKey QPOQRKUWBIAHBO-OJSHLMAWSA-L
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9)?

Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9) is a crysta...

Compound Q&A

How is Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9) typically synthesized?

Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine is synthesized through a mult...

Compound Q&A

What industries use Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9)?

Disodium 2'-deoxy-5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine (CAS: 72003-83-9) finds appli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...