Compound Q&A

What industries use Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

Answer

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1)
Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various medicinal compounds. It also finds application in the polymer industry for the development of novel materials with specific properties. Additionally, it is occasionally used in the production of sensors and as a reagent in certain chemical reactions.

About

CAS No 1454-53-1
English Name Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1)
Molecular Formula C15H20ClNO3
Molecular Weight 297.78 g/mol
SMILES CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2.Cl
InChIKey YPFMNHZRNXPYBG-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) is a crystalline compoun...

Compound Q&A

How is Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) typically synthesized?

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride is typically synthesized via a multistep ...

Compound Q&A

What precautions should be taken when handling Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

When handling Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...