Compound Q&A

How is Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) typically synthesized?

Answer

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1)
Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride is typically synthesized via a multistep process involving the condensation of ethyl 3-piperidinecarboxylate with benzylamine followed by hydrolysis and subsequent neutralization with hydrochloric acid. Commonly used catalysts include sodium hydride or potassium carbonate. The reaction yields are generally around 85-90%, and the product is isolated by recrystallization from an appropriate solvent.

About

CAS No 1454-53-1
English Name Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (1:1)
Molecular Formula C15H20ClNO3
Molecular Weight 297.78 g/mol
SMILES CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2.Cl
InChIKey YPFMNHZRNXPYBG-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) is a crystalline compoun...

Compound Q&A

What industries use Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1) is primarily used in the...

Compound Q&A

What precautions should be taken when handling Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1)?

When handling Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride (CAS: 1454-53-1), it is ess...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...