Compound Q&A

How is Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1) typically synthesized?

Answer

Dichloroplatinum - triphenylphosphine (1:2)
Dichloroplatinum - triphenylphosphine (1:2) is typically synthesized via a reaction between platinum(II) chloride and triphenylphosphine in a stoichiometric 1:2 molar ratio. The synthesis involves careful control of temperature and stirring to ensure good yield and selectivity.

About

CAS No 15604-36-1
English Name Dichloroplatinum - triphenylphosphine (1:2)
Molecular Formula C36H30Cl2P2Pt
Molecular Weight 790.57 g/mol
SMILES c1ccc(cc1)P(c2ccccc2)c3ccccc3.c1ccc(cc1)P(c2ccccc2)c3ccccc3.Cl[Pt]Cl
InChIKey XAFJSPPHVXDRIE-UHFFFAOYSA-L
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

Dichloroplatinum - triphenylphosphine (1:2) is a coordination compound with a molecular weight of ap...

Compound Q&A

What industries use Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

Dichloroplatinum - triphenylphosphine (1:2) is used in the pharmaceutical industry for catalytic app...

Compound Q&A

What precautions should be taken when handling Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

When handling Dichloroplatinum - triphenylphosphine (1:2), it is essential to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...