Compound Q&A

What are the physical and chemical properties of Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

Answer

Dichloroplatinum - triphenylphosphine (1:2)
Dichloroplatinum - triphenylphosphine (1:2) is a coordination compound with a molecular weight of approximately 518.4 g/mol. It exists in a crystalline form with poor water solubility. The compound is relatively stable but can react with strong reducing agents and bases. It is used in organic synthesis and catalytic reactions.

About

CAS No 15604-36-1
English Name Dichloroplatinum - triphenylphosphine (1:2)
Molecular Formula C36H30Cl2P2Pt
Molecular Weight 790.57 g/mol
SMILES c1ccc(cc1)P(c2ccccc2)c3ccccc3.c1ccc(cc1)P(c2ccccc2)c3ccccc3.Cl[Pt]Cl
InChIKey XAFJSPPHVXDRIE-UHFFFAOYSA-L
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1) typically synthesized?

Dichloroplatinum - triphenylphosphine (1:2) is typically synthesized via a reaction between platinum...

Compound Q&A

What industries use Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

Dichloroplatinum - triphenylphosphine (1:2) is used in the pharmaceutical industry for catalytic app...

Compound Q&A

What precautions should be taken when handling Dichloroplatinum - triphenylphosphine (1:2) (CAS: 15604-36-1)?

When handling Dichloroplatinum - triphenylphosphine (1:2), it is essential to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...