Compound Q&A

What industries use 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

Answer

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine
2-Chloro-5-nitro-3-(trifluoromethyl)pyridine is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also employed in the production of sensors and materials for electronic devices. Its high reactivity and specific functional groups make it valuable in these applications, although its use is limited due to its reactivity and potential hazards.

About

CAS No 99368-67-9
English Name 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine
Molecular Formula C6H2ClF3N2O2
Molecular Weight 226.54 g/mol
SMILES C1=C(C=NC(=C1C(F)(F)F)Cl)[N+](=O)[O-]
InChIKey OPEZLLCPUDLUFV-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9) typically synthesized?

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine can be synthesized via a multi-step process involving F...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

When handling 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...