Compound Q&A

How is 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9) typically synthesized?

Answer

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine
2-Chloro-5-nitro-3-(trifluoromethyl)pyridine can be synthesized via a multi-step process involving Friedel-Crafts alkylation and nitration of 3-chloro-5-(trifluoromethyl)pyridine. The key steps include the use of aluminum chloride as a catalyst for the alkylation, followed by the nitration using nitric acid and sulfuric acid. The yield is typically around 80%, with high selectivity towards the desired product.

About

CAS No 99368-67-9
English Name 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine
Molecular Formula C6H2ClF3N2O2
Molecular Weight 226.54 g/mol
SMILES C1=C(C=NC(=C1C(F)(F)F)Cl)[N+](=O)[O-]
InChIKey OPEZLLCPUDLUFV-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

2-Chloro-5-nitro-3-(trifluoromethyl)pyridine is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9)?

When handling 2-Chloro-5-nitro-3-(trifluoromethyl)pyridine (CAS: 99368-67-9), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...