Compound Q&A

How is 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene (CAS: 116-29-0) typically synthesized?

Answer

1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene
1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene is synthesized via a multi-step process involving the coupling of 4-chlorobenzenesulfonyl chloride with 1,2,4-trichlorobenzene. The reaction typically requires a Lewis acid catalyst and is carried out in an inert solvent. The overall yield is moderate, and the reaction is selective for the desired product.

About

CAS No 116-29-0
English Name 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene
Molecular Formula C12H6Cl4O2S
Molecular Weight 356.06 g/mol
SMILES O=S(C1=C(Cl)C=C(Cl)C(Cl)=C1)(C2=CC=C(Cl)C=C2)=O
InChIKey MLGCXEBRWGEOQX-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene (CAS: 116-29-0)?

1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene is a crystalline solid with a high molecular wei...

Compound Q&A

What industries use 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene (CAS: 116-29-0)?

1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene (CAS: 116-29-0)?

When handling 1,2,4-Trichloro-5-[(4-chlorophenyl)sulfonyl]benzene, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...