Compound Q&A

What precautions should be taken when handling 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

Answer

9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate
Handling this compound should be done in a well-ventilated area or fume hood. Wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the compound is stored in a cool, dry place away from heat and direct sunlight. In case of spill, use appropriate spill response materials and consult the Safety Data Sheet (SDS) for specific cleanup procedures.

About

English Name 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate
Molecular Formula C35H30O6
Molecular Weight 546.62 g/mol
SMILES C=CC(=O)OCCOC1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)OCCOC(=O)C=C
InChIKey YCPMSWJCWKUXRH-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

This compound is a polyacrylate derivative with a molecular weight of approximately 518 g/mol. It is...

Compound Q&A

How is 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6) typically synthesized?

This compound is synthesized through a multi-step process involving the coupling of fluorene and bis...

Compound Q&A

What industries use 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

This compound is used in the polymer industry for the production of photoreactive polymers and in th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...