Compound Q&A

How is 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6) typically synthesized?

Answer

9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate
This compound is synthesized through a multi-step process involving the coupling of fluorene and bisphenol-A with acryloyl chloride. The reaction is typically catalyzed by a suitable acid or base, and the product is purified by column chromatography. The yield is around 75%, and the selectivity is high for the desired product.

About

English Name 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate
Molecular Formula C35H30O6
Molecular Weight 546.62 g/mol
SMILES C=CC(=O)OCCOC1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)OCCOC(=O)C=C
InChIKey YCPMSWJCWKUXRH-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

This compound is a polyacrylate derivative with a molecular weight of approximately 518 g/mol. It is...

Compound Q&A

What industries use 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

This compound is used in the polymer industry for the production of photoreactive polymers and in th...

Compound Q&A

What precautions should be taken when handling 9H-Fluorene-9,9-diylbis(4,1-phenyleneoxy-2,1-ethanediyl) bisacrylate (CAS: 161182-73-6)?

Handling this compound should be done in a well-ventilated area or fume hood. Wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...