Compound Q&A

How is amino-PEG8-t-butyl ester (CAS: 756526-06-4) typically synthesized?

Answer

amino-PEG8-t-butyl ester
Amino-PEG8-t-butyl ester (CAS: 756526-06-4) is synthesized through the esterification of PEG8-t-butyl ester with an amino-containing compound. Commonly, the reaction involves the use of a catalyst such as 4-dimethylaminopyridine (DMAP) to enhance the reaction rate. The product yields are generally high, with good selectivity towards the desired esterification product.

About

English Name amino-PEG8-t-butyl ester
Molecular Formula C23H47NO10
Molecular Weight 497.62 g/mol
SMILES CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN
InChIKey UMJVFHNJPJVDSB-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of amino-PEG8-t-butyl ester (CAS: 756526-06-4)?

Amino-PEG8-t-butyl ester (CAS: 756526-06-4) is a water-soluble compound with a molecular weight of a...

Compound Q&A

What industries use amino-PEG8-t-butyl ester (CAS: 756526-06-4)?

Amino-PEG8-t-butyl ester (CAS: 756526-06-4) is primarily used in pharmaceuticals for drug delivery s...

Compound Q&A

What precautions should be taken when handling amino-PEG8-t-butyl ester (CAS: 756526-06-4)?

When handling amino-PEG8-t-butyl ester (CAS: 756526-06-4), it is important to wear protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...