Compound Q&A

What industries use Concanavalin A (CAS: 11028-71-0)?

Answer

Concanavalin A
Concanavalin A (ConA, CAS: 11028-71-0) is widely used in various industries. In pharmaceuticals, it is utilized for drug discovery and as a research tool. In biotechnology, ConA serves as a specific binding reagent for glycoproteins. It is also employed in the food industry as a quality control tool for detecting glycoproteins. Additionally, ConA finds applications in the development of biosensors and semiconductors due to its unique binding properties.

About

CAS No 11028-71-0
English Name Concanavalin A
Molecular Formula C23H32N6O8S
Molecular Weight 552.6 g/mol
SMILES CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)O.CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-]
InChIKey RVSZVJZFCQZYHQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Concanavalin A (CAS: 11028-71-0)?

Concanavalin A (ConA, CAS: 11028-71-0) is a glycoprotein with a molecular weight of approximately 40...

Compound Q&A

How is Concanavalin A (CAS: 11028-71-0) typically synthesized?

Concanavalin A (ConA, CAS: 11028-71-0) is typically synthesized through a combination of fermentatio...

Compound Q&A

What precautions should be taken when handling Concanavalin A (CAS: 11028-71-0)?

When handling Concanavalin A (ConA, CAS: 11028-71-0), it is essential to follow proper laboratory sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...