Compound Q&A

What precautions should be taken when handling 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

Answer

5-Amino-2-anilinobenzenesulfonic acid
When handling 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to prevent inhalation of fumes. Spills should be cleaned up with appropriate absorbents, and the area should be decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 91-30-5
English Name 5-Amino-2-anilinobenzenesulfonic acid
Molecular Formula C12H12N2O3S
Molecular Weight 264.31 g/mol
SMILES C1=CC=C(C=C1)NC2=C(C=C(C=C2)N)S(=O)(=O)O
InChIKey HYLOSPCJTPLXSF-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is a crystalline solid with a molecular weight ...

Compound Q&A

How is 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) typically synthesized?

5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is typically synthesized through a multi-step p...

Compound Q&A

What industries use 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is used in various industries. It is a key inte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...