Compound Q&A

What industries use 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

Answer

5-Amino-2-anilinobenzenesulfonic acid
5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is used in various industries. It is a key intermediate in the synthesis of dyes and pigments, pharmaceuticals, and as a component in certain analytical reagents. Additionally, it plays a role in the development of sensors and in the production of some semiconductors.

About

CAS No 91-30-5
English Name 5-Amino-2-anilinobenzenesulfonic acid
Molecular Formula C12H12N2O3S
Molecular Weight 264.31 g/mol
SMILES C1=CC=C(C=C1)NC2=C(C=C(C=C2)N)S(=O)(=O)O
InChIKey HYLOSPCJTPLXSF-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is a crystalline solid with a molecular weight ...

Compound Q&A

How is 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) typically synthesized?

5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5) is typically synthesized through a multi-step p...

Compound Q&A

What precautions should be taken when handling 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5)?

When handling 5-Amino-2-anilinobenzenesulfonic acid (CAS: 91-30-5), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...