Compound Q&A

What precautions should be taken when handling (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

Answer

(Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium
Proper personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be handled by neutralizing with a base, followed by thorough cleaning. Always refer to the safety data sheet (SDS) for detailed handling and disposal information.

About

English Name (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium
Molecular Formula C9H8NNaO3
Molecular Weight 201.15 g/mol
SMILES CC(=CC(=O)[O-])C(=O)C1=CC=CN1.[Na+]
InChIKey PAWITTAEJDSROT-YSMBQZINSA-M
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

This compound is a white crystalline solid with a molecular weight of approximately 256.28 g/mol. It...

Compound Q&A

How is (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0) typically synthesized?

This compound can be synthesized via a condensation reaction between an appropriate aldehyde and 2-p...

Compound Q&A

What industries use (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

This compound is used in the pharmaceutical industry for its potential as a precursor to various bio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...