Compound Q&A

What are the physical and chemical properties of (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

Answer

(Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium
This compound is a white crystalline solid with a molecular weight of approximately 256.28 g/mol. It is slightly soluble in water and has good solubility in organic solvents. Chemically, it is moderately reactive, especially under acidic conditions. It forms stable crystalline structures and has good thermal stability up to 150°C.

About

English Name (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium
Molecular Formula C9H8NNaO3
Molecular Weight 201.15 g/mol
SMILES CC(=CC(=O)[O-])C(=O)C1=CC=CN1.[Na+]
InChIKey PAWITTAEJDSROT-YSMBQZINSA-M
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0) typically synthesized?

This compound can be synthesized via a condensation reaction between an appropriate aldehyde and 2-p...

Compound Q&A

What industries use (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

This compound is used in the pharmaceutical industry for its potential as a precursor to various bio...

Compound Q&A

What precautions should be taken when handling (Z)-3-methyl-4-oxo-4-(1H-pyrrol-2-yl)but-2-enoic acid sodium (CAS: 418541-41-0)?

Proper personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...