Compound Q&A

What industries use Trichloroacetic anhydride (CAS: 4124-31-6)?

Answer

Trichloroacetic anhydride
Trichloroacetic anhydride is used in the pharmaceutical industry for the synthesis of various drugs, in polymer chemistry for modifying polymers, and in the semiconductor industry for etching processes. It is also used in analytical chemistry as a derivatizing agent.

About

CAS No 4124-31-6
English Name Trichloroacetic anhydride
Molecular Formula C4Cl6O3
Molecular Weight 308.759 g/mol
SMILES C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl
InChIKey MEFKFJOEVLUFAY-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trichloroacetic anhydride (CAS: 4124-31-6)?

Trichloroacetic anhydride is a white crystalline solid with a molecular weight of 165.48 g/mol. It i...

Compound Q&A

How is Trichloroacetic anhydride (CAS: 4124-31-6) typically synthesized?

Trichloroacetic anhydride is typically synthesized by the dehydration of trichloroacetic acid. This ...

Compound Q&A

What precautions should be taken when handling Trichloroacetic anhydride (CAS: 4124-31-6)?

When handling Trichloroacetic anhydride, appropriate personal protective equipment (PPE) such as glo...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...