Compound Q&A

How is Trichloroacetic anhydride (CAS: 4124-31-6) typically synthesized?

Answer

Trichloroacetic anhydride
Trichloroacetic anhydride is typically synthesized by the dehydration of trichloroacetic acid. This is achieved by heating trichloroacetic acid under anhydrous conditions, often catalyzed by a strong acid. The reaction is exothermic, and the yield is generally high.

About

CAS No 4124-31-6
English Name Trichloroacetic anhydride
Molecular Formula C4Cl6O3
Molecular Weight 308.759 g/mol
SMILES C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl
InChIKey MEFKFJOEVLUFAY-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trichloroacetic anhydride (CAS: 4124-31-6)?

Trichloroacetic anhydride is a white crystalline solid with a molecular weight of 165.48 g/mol. It i...

Compound Q&A

What industries use Trichloroacetic anhydride (CAS: 4124-31-6)?

Trichloroacetic anhydride is used in the pharmaceutical industry for the synthesis of various drugs,...

Compound Q&A

What precautions should be taken when handling Trichloroacetic anhydride (CAS: 4124-31-6)?

When handling Trichloroacetic anhydride, appropriate personal protective equipment (PPE) such as glo...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...