Compound Q&A

How is Trichloroacetic anhydride (CAS: 4124-31-6) typically synthesized?

Answer

Trichloroacetic anhydride
Trichloroacetic anhydride is typically synthesized by the dehydration of trichloroacetic acid. This is achieved by heating trichloroacetic acid under anhydrous conditions, often catalyzed by a strong acid. The reaction is exothermic, and the yield is generally high.

About

CAS No 4124-31-6
English Name Trichloroacetic anhydride
Molecular Formula C4Cl6O3
Molecular Weight 308.76 g/mol
SMILES C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl
InChIKey MEFKFJOEVLUFAY-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trichloroacetic anhydride (CAS: 4124-31-6)?

Trichloroacetic anhydride is a white crystalline solid with a molecular weight of 165.48 g/mol. It i...

Compound Q&A

What industries use Trichloroacetic anhydride (CAS: 4124-31-6)?

Trichloroacetic anhydride is used in the pharmaceutical industry for the synthesis of various drugs,...

Compound Q&A

What precautions should be taken when handling Trichloroacetic anhydride (CAS: 4124-31-6)?

When handling Trichloroacetic anhydride, appropriate personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...