Compound Q&A

How is Cyclohexylmagnesium Bromide (CAS: 931-50-0) typically synthesized?

Answer

Cyclohexylmagnesium Bromide
Cyclohexylmagnesium Bromide is typically synthesized by reacting cyclohexyl bromide with magnesium in an inert solvent such as tetrahydrofuran (THF). This reaction is carried out under anhydrous and nitrogen-purged conditions to avoid side reactions. The yield is typically around 80-90%.

About

CAS No 931-50-0
English Name Cyclohexylmagnesium Bromide
Molecular Formula C6H11BrMg
Molecular Weight 187.36 g/mol
SMILES C1CC[CH-]CC1.[Mg+2].[Br-]
InChIKey SJUKXVKSGSJVTJ-UHFFFAOYSA-M
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

Cyclohexylmagnesium Bromide (CAS: 931-50-0) is a colorless or slightly yellow liquid with a molecula...

Compound Q&A

What industries use Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

Cyclohexylmagnesium Bromide (CAS: 931-50-0) is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

When handling Cyclohexylmagnesium Bromide (CAS: 931-50-0), use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...