Compound Q&A

What are the physical and chemical properties of Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

Answer

Cyclohexylmagnesium Bromide
Cyclohexylmagnesium Bromide (CAS: 931-50-0) is a colorless or slightly yellow liquid with a molecular weight of approximately 126.75 g/mol. It is slightly soluble in water but highly soluble in ethanol and other polar solvents. This compound is highly reactive, undergoing elimination reactions and other nucleophilic displacement reactions.

About

CAS No 931-50-0
English Name Cyclohexylmagnesium Bromide
Molecular Formula C6H11BrMg
Molecular Weight 187.36 g/mol
SMILES C1CC[CH-]CC1.[Mg+2].[Br-]
InChIKey SJUKXVKSGSJVTJ-UHFFFAOYSA-M
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is Cyclohexylmagnesium Bromide (CAS: 931-50-0) typically synthesized?

Cyclohexylmagnesium Bromide is typically synthesized by reacting cyclohexyl bromide with magnesium i...

Compound Q&A

What industries use Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

Cyclohexylmagnesium Bromide (CAS: 931-50-0) is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling Cyclohexylmagnesium Bromide (CAS: 931-50-0)?

When handling Cyclohexylmagnesium Bromide (CAS: 931-50-0), use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...