Compound Q&A

What industries use Aclonifen (CAS: 74070-46-5)?

Answer

Aclonifen
Aclonifen (CAS: 74070-46-5) is primarily used in the agricultural industry for weed control. It is also used in some industrial applications for its herbicidal properties. While it is not extensively used in pharmaceuticals, it has potential applications in sensor technology and as a precursor in the synthesis of other compounds.

About

CAS No 74070-46-5
English Name Aclonifen
Molecular Formula C12H9ClN2O3
Molecular Weight 264.66 g/mol
SMILES C1=CC=C(C=C1)OC2=C(C(=C(C=C2)[N+](=O)[O-])N)Cl
InChIKey DDBMQDADIHOWIC-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aclonifen (CAS: 74070-46-5)?

Aclonifen (CAS: 74070-46-5) is a crystalline compound with a molecular weight of approximately 424.8...

Compound Q&A

How is Aclonifen (CAS: 74070-46-5) typically synthesized?

Aclonifen (CAS: 74070-46-5) is typically synthesized through a multi-step process involving the use ...

Compound Q&A

What precautions should be taken when handling Aclonifen (CAS: 74070-46-5)?

When handling Aclonifen (CAS: 74070-46-5), it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...