Compound Q&A

How is Aclonifen (CAS: 74070-46-5) typically synthesized?

Answer

Aclonifen
Aclonifen (CAS: 74070-46-5) is typically synthesized through a multi-step process involving the use of acetylenic intermediates and a series of reactions including alkylation and acylation. Common catalysts used include Lewis acids and metal complexes. The synthesis yields are generally high, and the process is optimized for selectivity and purity.

About

CAS No 74070-46-5
English Name Aclonifen
Molecular Formula C12H9ClN2O3
Molecular Weight 264.66 g/mol
SMILES C1=CC=C(C=C1)OC2=C(C(=C(C=C2)[N+](=O)[O-])N)Cl
InChIKey DDBMQDADIHOWIC-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aclonifen (CAS: 74070-46-5)?

Aclonifen (CAS: 74070-46-5) is a crystalline compound with a molecular weight of approximately 424.8...

Compound Q&A

What industries use Aclonifen (CAS: 74070-46-5)?

Aclonifen (CAS: 74070-46-5) is primarily used in the agricultural industry for weed control. It is a...

Compound Q&A

What precautions should be taken when handling Aclonifen (CAS: 74070-46-5)?

When handling Aclonifen (CAS: 74070-46-5), it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...