Compound Q&A

What industries use N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

Answer

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (1:1)
N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) is primarily used in the pharmaceutical industry for its biological activity. It is also explored in research for its potential applications in polymers and sensors. Due to its unique chemical structure, it may be used in specialized formulations and as a research tool in various scientific fields.

About

English Name N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (1:1)
Molecular Formula C11H23ClN4O4
Molecular Weight 310.78 g/mol
SMILES Cl.CC(C)(C)OC(=O)N[C@H](CCCNC(=N)N)C(=O)O
InChIKey HDELGKMVZYHPPB-OGFXRTJISA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) is a crystalli...

Compound Q&A

How is N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) typically synthesized?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride is typically synthesized by the a...

Compound Q&A

What precautions should be taken when handling N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

When handling N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...