Compound Q&A

What are the physical and chemical properties of N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

Answer

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (1:1)
N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) is a crystalline compound with a molecular weight of approximately 386.39 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is known for its basicity, with a pKa of around 10. It is stable under normal storage conditions but can degrade under acidic or oxidative conditions.

About

English Name N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (1:1)
Molecular Formula C11H23ClN4O4
Molecular Weight 310.78 g/mol
SMILES Cl.CC(C)(C)OC(=O)N[C@H](CCCNC(=N)N)C(=O)O
InChIKey HDELGKMVZYHPPB-OGFXRTJISA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) typically synthesized?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride is typically synthesized by the a...

Compound Q&A

What industries use N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4) is primarily u...

Compound Q&A

What precautions should be taken when handling N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4)?

When handling N~2~-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-arginine hydrochloride (CAS: 113712-06-4),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...