Compound Q&A

What industries use 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

Answer

4-Anilino-1-benzyl-4-piperidinecarboxylic acid
4-Anilino-1-benzyl-4-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for the synthesis of drugs. It is also utilized in the production of polymers and sensors due to its unique chemical structure. Its use in semiconductors is less common but has potential applications in materials chemistry for electronic devices.

About

CAS No 85098-64-2
English Name 4-Anilino-1-benzyl-4-piperidinecarboxylic acid
Molecular Formula C19H22N2O2
Molecular Weight 310.4 g/mol
SMILES O=C(C1(NC2=CC=CC=C2)CCN(CC3=CC=CC=C3)CC1)O
InChIKey YFSCBWDAVTYIMM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

4-Anilino-1-benzyl-4-piperidinecarboxylic acid is a white crystalline solid with a molecular weight ...

Compound Q&A

How is 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2) typically synthesized?

4-Anilino-1-benzyl-4-piperidinecarboxylic acid can be synthesized via a multistep process involving ...

Compound Q&A

What precautions should be taken when handling 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

When handling 4-Anilino-1-benzyl-4-piperidinecarboxylic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...