Compound Q&A

How is 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2) typically synthesized?

Answer

4-Anilino-1-benzyl-4-piperidinecarboxylic acid
4-Anilino-1-benzyl-4-piperidinecarboxylic acid can be synthesized via a multistep process involving the condensation of 4-hydroxypiperidine and benzyl anilide followed by acylation. This method yields a mixture of isomers, but the desired product can be isolated through column chromatography. The synthesis typically involves the use of catalysts and reagents like triethylamine and dichloromethane, achieving a yield of around 70-80%.

About

CAS No 85098-64-2
English Name 4-Anilino-1-benzyl-4-piperidinecarboxylic acid
Molecular Formula C19H22N2O2
Molecular Weight 310.4 g/mol
SMILES O=C(C1(NC2=CC=CC=C2)CCN(CC3=CC=CC=C3)CC1)O
InChIKey YFSCBWDAVTYIMM-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

4-Anilino-1-benzyl-4-piperidinecarboxylic acid is a white crystalline solid with a molecular weight ...

Compound Q&A

What industries use 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

4-Anilino-1-benzyl-4-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 4-Anilino-1-benzyl-4-piperidinecarboxylic acid (CAS: 85098-64-2)?

When handling 4-Anilino-1-benzyl-4-piperidinecarboxylic acid, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...