Compound Q&A

How is [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9) typically synthesized?

Answer

[5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper
Synthesis of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper involves the metalation of a tetraphenylporphyrin using copper chloride or copper(II) acetate as the metal source. The reaction is typically conducted in a polar solvent under mild conditions. The yield is generally good, with selectivity towards the desired copper complex.

About

CAS No 14172-91-9
English Name [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper
Molecular Formula C44H28CuN4
Molecular Weight 678.3 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)N3.[Cu+2]
InChIKey RKTYLMNFRDHKIL-DAJBKUBHSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

The physical and chemical properties of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]...

Compound Q&A

What industries use [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

This copper complex is widely used in the pharmaceutical industry for its potential as a photosensit...

Compound Q&A

What precautions should be taken when handling [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

When handling [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper, it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...