Compound Q&A

What are the physical and chemical properties of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

Answer

[5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper
The physical and chemical properties of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper include a high molecular weight and a crystalline form. It is poorly soluble in common organic solvents but soluble in polar solvents like dimethyl sulfoxide (DMSO). The compound shows moderate reactivity, particularly towards metal ion substitution. It is known for its stability and ability to provide electronic properties useful in various applications.

About

CAS No 14172-91-9
English Name [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper
Molecular Formula C44H28CuN4
Molecular Weight 678.3 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)N3.[Cu+2]
InChIKey RKTYLMNFRDHKIL-DAJBKUBHSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9) typically synthesized?

Synthesis of [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper involves the metalat...

Compound Q&A

What industries use [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

This copper complex is widely used in the pharmaceutical industry for its potential as a photosensit...

Compound Q&A

What precautions should be taken when handling [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper (CAS: 14172-91-9)?

When handling [5,10,15,20-Tetraphenylporphyrinato(2-)-kappa~2~N~21~,N~23~]copper, it is important to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...