Compound Q&A

How should 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5) be stored?

Answer

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent moisture absorption and degradation. Avoid storing it near incompatible materials, such as bases or reducing agents, to prevent chemical reactions.

About

English Name 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
Molecular Formula C18H11N3O6
Molecular Weight 365.3 g/mol
SMILES C1=CN=C(C=C1C(=O)O)C2=CC(=CC(=N2)C3=NC=CC(=C3)C(=O)O)C(=O)O
InChIKey NTXWAWVRPLVLKC-UHFFFAOYSA-N
Last Updated: 2025-10-09 22:25

Related Q&A

Compound Q&A

What is 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5)?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is a complex organic compound with the formula C...

Compound Q&A

What are the main uses of 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5)?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is primarily used in the synthesis of metal comp...

Compound Q&A

Is 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5) safe?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is generally considered safe when handled proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...