Compound Q&A

What is 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5)?

Answer

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is a complex organic compound with the formula C18H12N6O6. It is characterized by its terpyridine core with carboxylic acid groups attached, making it useful in various applications due to its unique electronic and structural properties.

About

English Name 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
Molecular Formula C18H11N3O6
Molecular Weight 365.3 g/mol
SMILES C1=CN=C(C=C1C(=O)O)C2=CC(=CC(=N2)C3=NC=CC(=C3)C(=O)O)C(=O)O
InChIKey NTXWAWVRPLVLKC-UHFFFAOYSA-N
Last Updated: 2025-10-09 22:25

Related Q&A

Compound Q&A

What are the main uses of 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5)?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is primarily used in the synthesis of metal comp...

Compound Q&A

Is 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5) safe?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is generally considered safe when handled proper...

Compound Q&A

How should 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid (CAS: 216018-58-5) be stored?

2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...