Compound Q&A

What are the main uses of ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1)?

Answer

ethyl (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate
This compound is primarily used in pharmaceuticals, particularly as an intermediate or building block for synthesizing other chemical entities. It may also have applications in medicinal chemistry, material science, and research due to its specific structural features and chemical reactivity.

About

English Name ethyl (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate
Molecular Formula C21H27NO5
Molecular Weight 373.45 g/mol
SMILES CCOC(=O)OC1=C(C(=O)N[C@]21CC[C@@H](CC2)OC)c3cc(C)ccc3C
InChIKey CLSVJBIHYWPGQY-UHFFFAOYSA-N
Last Updated: 2025-10-09 15:43

Related Q&A

Compound Q&A

What is (5S,8S)-3-(2,5-Dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1)?

Ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate is a com...

Compound Q&A

Is ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1) safe?

The safety of this compound is generally acceptable when handled and stored properly. However, it is...

Compound Q&A

How should ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1) be stored?

This compound should be stored in a cool, dry environment, preferably in a temperature-controlled ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...