Compound Q&A

What is (5S,8S)-3-(2,5-Dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1)?

Answer

ethyl (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate
Ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate is a complex organic compound with a unique structure. It is an azaspiro compound with a dimethylphenyl, methoxy, and carbonate functional groups. It has a molecular formula of C21H25NO4 and a molecular weight of approximately 353.47 g/mol. This compound is often used in pharmaceutical and medicinal applications for its specific chemical properties.

About

English Name ethyl (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate
Molecular Formula C21H27NO5
Molecular Weight 373.45 g/mol
SMILES CCOC(=O)OC1=C(C(=O)N[C@]21CC[C@@H](CC2)OC)c3cc(C)ccc3C
InChIKey CLSVJBIHYWPGQY-UHFFFAOYSA-N
Last Updated: 2025-10-09 15:43

Related Q&A

Compound Q&A

What are the main uses of ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1)?

This compound is primarily used in pharmaceuticals, particularly as an intermediate or building bloc...

Compound Q&A

Is ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1) safe?

The safety of this compound is generally acceptable when handled and stored properly. However, it is...

Compound Q&A

How should ethyl (5S,8S)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl carbonate (CAS: 203313-25-1) be stored?

This compound should be stored in a cool, dry environment, preferably in a temperature-controlled ar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...