Compound Q&A

How should Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) be stored?

Answer

Deoxyribonucleic acids, fish sperm
Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) should be stored in a desiccator at a temperature between 4-8°C to maintain its stability. Avoid exposure to light and maintain a stable environment with minimal humidity fluctuations. The compound should be kept in a tightly sealed container to prevent degradation and contamination.

About

English Name Deoxyribonucleic acids, fish sperm
Molecular Formula Null
Molecular Weight 523.37 g/mol
EINECS 309-566-6
SMILES OCC1OC(N)CC1OP(OCC1OC(N)CC1OP(OCC1OC(N)CC1O)(O)=O)(O)=O
InChIKey AWBASQCACWFTGD-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What is Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5)?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is a purified form of DNA isolated from fish s...

Compound Q&A

What are the main uses of Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5)?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is primarily used in molecular biology for clo...

Compound Q&A

Is Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) safe?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is generally considered safe for laboratory us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...