Compound Q&A

What is Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5)?

Answer

Deoxyribonucleic acids, fish sperm
Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is a purified form of DNA isolated from fish sperm. It is a long-chain polymer composed of nucleotides, which are the building blocks of genetic material. This compound is often used in research and biotechnology applications due to its high purity and biological activity.

About

English Name Deoxyribonucleic acids, fish sperm
Molecular Formula Null
Molecular Weight 523.37 g/mol
EINECS 309-566-6
SMILES OCC1OC(N)CC1OP(OCC1OC(N)CC1OP(OCC1OC(N)CC1O)(O)=O)(O)=O
InChIKey AWBASQCACWFTGD-UHFFFAOYSA-N
Last Updated: 2025-10-09 11:55

Related Q&A

Compound Q&A

What are the main uses of Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5)?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is primarily used in molecular biology for clo...

Compound Q&A

Is Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) safe?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) is generally considered safe for laboratory us...

Compound Q&A

How should Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) be stored?

Deoxyribonucleic acids, fish sperm (CAS: 100403-24-5) should be stored in a desiccator at a temperat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...