Compound Q&A

What industries use 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

Answer

1-(1-Pyrenyl)methanamine hydrochloride (1:1)
1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) is utilized in various industries. It is commonly used in pharmaceuticals for its fluorescent properties, aiding in drug discovery and analysis. In the polymer industry, it is used as a fluorescent label for polymer characterization. Additionally, it finds applications in sensors for detection and semiconductors due to its strong fluorescence under UV light.

About

CAS No 93324-65-3
English Name 1-(1-Pyrenyl)methanamine hydrochloride (1:1)
Molecular Formula C17H14ClN
Molecular Weight 267.76 g/mol
SMILES C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CN.Cl
InChIKey RGNMXKKNDSHTFD-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) is a crystalline solid with a molecular wei...

Compound Q&A

How is 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) typically synthesized?

1-(1-Pyrenyl)methanamine hydrochloride is synthesized by the reaction of 1-pyrenylmethanone with pri...

Compound Q&A

What precautions should be taken when handling 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

When handling 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3), it is essential to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...