Compound Q&A

How is 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) typically synthesized?

Answer

1-(1-Pyrenyl)methanamine hydrochloride (1:1)
1-(1-Pyrenyl)methanamine hydrochloride is synthesized by the reaction of 1-pyrenylmethanone with primary amines followed by the addition of hydrochloric acid. Commonly, the reaction is carried out under mild conditions, and the product is purified by recrystallization from ethanol. The yield is typically around 75-85%, and the reaction is known for its good selectivity and ease of preparation.

About

CAS No 93324-65-3
English Name 1-(1-Pyrenyl)methanamine hydrochloride (1:1)
Molecular Formula C17H14ClN
Molecular Weight 267.76 g/mol
SMILES C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CN.Cl
InChIKey RGNMXKKNDSHTFD-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3) is utilized in various industries. It is co...

Compound Q&A

What precautions should be taken when handling 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3)?

When handling 1-(1-Pyrenyl)methanamine hydrochloride (CAS: 93324-65-3), it is essential to use perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...