Compound Q&A

How is (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) typically synthesized?

Answer

(2,3,4,5-Tetrafluorophenyl)methanol
(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is typically synthesized through a hydrogenation reaction of (2,3,4,5-tetrafluorophenyl)methyl ketone using a hydrogenation catalyst such as palladium on carbon. The process involves treating the ketone with hydrogen gas in the presence of the catalyst to form the desired alcohol. The yield of the reaction is generally high, and the method is selective and efficient.

About

CAS No 53072-18-7
English Name (2,3,4,5-Tetrafluorophenyl)methanol
Molecular Formula C7H4F4O
Molecular Weight 180.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)F)F)CO
InChIKey HLUZGUMMQYQHKJ-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is a colorless to white crystalline solid with...

Compound Q&A

What industries use (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is used in various industries. It is a key int...

Compound Q&A

What precautions should be taken when handling (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

When handling (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7), it is important to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...