Compound Q&A

What are the physical and chemical properties of (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

Answer

(2,3,4,5-Tetrafluorophenyl)methanol
(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is a colorless to white crystalline solid with a molecular weight of approximately 203.07 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It exists as a solid at room temperature and is stable under normal conditions, but it should be handled with care due to its potential to react with various reagents.

About

CAS No 53072-18-7
English Name (2,3,4,5-Tetrafluorophenyl)methanol
Molecular Formula C7H4F4O
Molecular Weight 180.1 g/mol
SMILES C1=C(C(=C(C(=C1F)F)F)F)CO
InChIKey HLUZGUMMQYQHKJ-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) typically synthesized?

(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is typically synthesized through a hydrogenati...

Compound Q&A

What industries use (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

(2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7) is used in various industries. It is a key int...

Compound Q&A

What precautions should be taken when handling (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7)?

When handling (2,3,4,5-Tetrafluorophenyl)methanol (CAS: 53072-18-7), it is important to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...