Compound Q&A

How is Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) typically synthesized?

Answer

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate
Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) is typically synthesized through the alkylation of linoleic acid with methanol in the presence of a strong acid catalyst like sulfuric acid. The reaction is usually carried out at room temperature with a yield of around 75-85%, and the product is purified by recrystallization.

About

CAS No 16326-32-2
English Name Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate
Molecular Formula C19H32O2
Molecular Weight 292.46 g/mol
SMILES CCCCCC=CCC=CCC=CCCCCC(=O)OC
InChIKey JFRWATCOFCPIBM-JPFHKJGASA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) is a crystalline compound with a molec...

Compound Q&A

What industries use Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

When handling Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2), it is crucial to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...