Compound Q&A

What are the physical and chemical properties of Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

Answer

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate
Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) is a crystalline compound with a molecular weight of approximately 238.32 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. The compound exhibits reactivity towards nucleophiles and can undergo addition reactions. It is commonly used in the synthesis of other compounds and has low volatility.

About

CAS No 16326-32-2
English Name Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate
Molecular Formula C19H32O2
Molecular Weight 292.46 g/mol
SMILES CCCCCC=CCC=CCC=CCCCCC(=O)OC
InChIKey JFRWATCOFCPIBM-JPFHKJGASA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) typically synthesized?

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) is typically synthesized through the a...

Compound Q&A

What industries use Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2) finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2)?

When handling Methyl (6Z,9Z,12Z)-6,9,12-octadecatrienoate (CAS: 16326-32-2), it is crucial to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...