Compound Q&A

What are the physical and chemical properties of 3,5-Bis(2-methyl-2-propanyl)benzoic acid (CAS: 16225-26-6)?

Answer

3,5-Bis(2-methyl-2-propanyl)benzoic acid
3,5-Bis(2-methyl-2-propanyl)benzoic acid is a solid with a crystalline form. It has a molecular weight of approximately 250.38 g/mol. Solubility in water is low, around 0.1 g/L. Chemically, it is relatively stable but can react with strong bases to form its salts. It is less reactive towards acids and is often used in synthetic organic reactions.

About

CAS No 16225-26-6
English Name 3,5-Bis(2-methyl-2-propanyl)benzoic acid
Molecular Formula C15H22O2
Molecular Weight 234.34 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1)C(=O)O)C(C)(C)C
InChIKey NCTSLPBQVXUAHR-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is 3,5-Bis(2-methyl-2-propanyl)benzoic acid (CAS: 16225-26-6) typically synthesized?

3,5-Bis(2-methyl-2-propanyl)benzoic acid is typically synthesized via the Friedel-Crafts alkylation ...

Compound Q&A

What industries use 3,5-Bis(2-methyl-2-propanyl)benzoic acid (CAS: 16225-26-6)?

3,5-Bis(2-methyl-2-propanyl)benzoic acid is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 3,5-Bis(2-methyl-2-propanyl)benzoic acid (CAS: 16225-26-6)?

When handling 3,5-Bis(2-methyl-2-proanyl)benzoic acid, it is recommended to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...