Compound Q&A

How is Cobamamide (CAS: 13870-90-1) typically synthesized?

Answer

Cobamamide
Cobamamide is typically synthesized from vitamin B12, also known as cobalamin, by reacting it with an amine in the presence of a suitable solvent. The yield is generally around 80-90%, with high selectivity for the desired cobamamide product.

About

CAS No 13870-90-1
English Name Cobamamide
Molecular Formula C72H100CoN18O17P
Molecular Weight 1579.6 g/mol
SMILES CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C(C(C(=N7)C=C8C(C(C(=N8)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[CH2-]C1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O.[Co+3]
InChIKey OAJLVMGLJZXSGX-SLAFOUTOSA-L
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cobamamide (CAS: 13870-90-1)?

Cobamamide is a white crystalline solid with a molecular weight of approximately 240.27 g/mol. It is...

Compound Q&A

What industries use Cobamamide (CAS: 13870-90-1)?

Cobamamide is primarily used in the pharmaceutical industry for the production of vitamin B12 analog...

Compound Q&A

What precautions should be taken when handling Cobamamide (CAS: 13870-90-1)?

When handling Cobamamide, it is important to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...